C25H28N2O4 — CID 56556066
3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]propanamide (PubChem CID 56556066) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]propanamide.
| Compound Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 56556066 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[4-(3-methylpyrrolidin-1-yl)phenyl]propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)Nc3ccc(N4CCC(C)C4)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H28N2O4/c1-16-12-13-27(15-16)19-6-4-18(5-7-19)26-24(28)11-10-22-17(2)21-9-8-20(30-3)14-23(21)31-25(22)29/h4-9,14,16H,10-13,15H2,1-3H3,(H,26,28) |
| InChIKey | ABTJUMPRSCHDAK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|