C19H23NO5 — CID 51296291
7-methoxy-4-methyl-3-[3-(2-methylmorpholin-4-yl)-3-oxopropyl]chromen-2-one (PubChem CID 51296291) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 7-methoxy-4-methyl-3-[3-(2-methylmorpholin-4-yl)-3-oxopropyl]chromen-2-one.
| Compound Name | 7-methoxy-4-methyl-3-[3-(2-methylmorpholin-4-yl)-3-oxopropyl]chromen-2-one |
|---|---|
| PubChem CID | 51296291 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 7-methoxy-4-methyl-3-[3-(2-methylmorpholin-4-yl)-3-oxopropyl]chromen-2-one |
| SMILES | COc1ccc2c(C)c(CCC(=O)N3CCOC(C)C3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H23NO5/c1-12-11-20(8-9-24-12)18(21)7-6-16-13(2)15-5-4-14(23-3)10-17(15)25-19(16)22/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | MKJMAIHAOWPNCV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|