C21H29ClN2O4 — CID 119593452
3-[3-[3-(1-aminoethyl)piperidin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one;hydrochloride (PubChem CID 119593452) has the molecular formula C21H29ClN2O4 and a molecular weight of 408.93 g/mol. Its IUPAC name is 3-[3-[3-(1-aminoethyl)piperidin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one;hydrochloride.
| Compound Name | 3-[3-[3-(1-aminoethyl)piperidin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 119593452 |
| Molecular Formula | C21H29ClN2O4 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[3-[3-(1-aminoethyl)piperidin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one;hydrochloride |
| SMILES | COc1ccc2c(C)c(CCC(=O)N3CCCC(C(C)N)C3)c(=O)oc2c1.Cl |
| InChI | InChI=1S/C21H28N2O4.ClH/c1-13-17-7-6-16(26-3)11-19(17)27-21(25)18(13)8-9-20(24)23-10-4-5-15(12-23)14(2)22;/h6-7,11,14-15H,4-5,8-10,12,22H2,1-3H3;1H |
| InChIKey | SCOSJKDYNRLZEU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|