C19H21NO6 — CID 40854959
(3R)-1-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoyl]piperidine-3-carboxylic acid (PubChem CID 40854959) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is (3R)-1-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 40854959 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (3R)-1-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoyl]piperidine-3-carboxylic acid |
| SMILES | Cc1c(CCC(=O)N2CCC[C@@H](C(=O)O)C2)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C19H21NO6/c1-11-14-5-4-13(21)9-16(14)26-19(25)15(11)6-7-17(22)20-8-2-3-12(10-20)18(23)24/h4-5,9,12,21H,2-3,6-8,10H2,1H3,(H,23,24)/t12-/m1/s1 |
| InChIKey | AASNJZKAXNNCFH-GFCCVEGCSA-N |
| XLogP | 2.06 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|