C22H23NO6 — CID 40816082
(3R)-1-[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]piperidine-3-carboxylic acid (PubChem CID 40816082) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is (3R)-1-[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 40816082 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (3R)-1-[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]piperidine-3-carboxylic acid |
| SMILES | Cc1oc2cc3oc(=O)c(CC(=O)N4CCC[C@@H](C(=O)O)C4)c(C)c3cc2c1C |
| InChI | InChI=1S/C22H23NO6/c1-11-13(3)28-18-9-19-16(7-15(11)18)12(2)17(22(27)29-19)8-20(24)23-6-4-5-14(10-23)21(25)26/h7,9,14H,4-6,8,10H2,1-3H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | QADHZFBIOZXPRB-CQSZACIVSA-N |
| XLogP | 3.33 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|