C22H25NO4 — CID 4914357
2,3,4,9-tetramethyl-8-(2-oxo-2-piperidin-1-ylethyl)furo[2,3-f]chromen-7-one (PubChem CID 4914357) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2,3,4,9-tetramethyl-8-(2-oxo-2-piperidin-1-ylethyl)furo[2,3-f]chromen-7-one.
| Compound Name | 2,3,4,9-tetramethyl-8-(2-oxo-2-piperidin-1-ylethyl)furo[2,3-f]chromen-7-one |
|---|---|
| PubChem CID | 4914357 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2,3,4,9-tetramethyl-8-(2-oxo-2-piperidin-1-ylethyl)furo[2,3-f]chromen-7-one |
| SMILES | Cc1oc2c(c(C)cc3oc(=O)c(CC(=O)N4CCCCC4)c(C)c32)c1C |
| InChI | InChI=1S/C22H25NO4/c1-12-10-17-20(21-19(12)13(2)15(4)26-21)14(3)16(22(25)27-17)11-18(24)23-8-6-5-7-9-23/h10H,5-9,11H2,1-4H3 |
| InChIKey | GPKZXHUWSIUQLB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|