C31H36N2O4 — CID 154808755
8-[2-[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3,4,9-trimethylfuro[2,3-f]chromen-7-one (PubChem CID 154808755) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is 8-[2-[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3,4,9-trimethylfuro[2,3-f]chromen-7-one.
| Compound Name | 8-[2-[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3,4,9-trimethylfuro[2,3-f]chromen-7-one |
|---|---|
| PubChem CID | 154808755 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 8-[2-[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3,4,9-trimethylfuro[2,3-f]chromen-7-one |
| SMILES | Cc1coc2c1c(C)cc1oc(=O)c(CC(=O)N3CCCC4=C[C@@H]5C[C@@H](CN6CCCC[C@H]56)[C@@H]43)c(C)c12 |
| InChI | InChI=1S/C31H36N2O4/c1-17-11-25-28(30-27(17)18(2)16-36-30)19(3)23(31(35)37-25)14-26(34)33-10-6-7-20-12-21-13-22(29(20)33)15-32-9-5-4-8-24(21)32/h11-12,16,21-22,24,29H,4-10,13-15H2,1-3H3/t21-,22+,24-,29-/m1/s1 |
| InChIKey | APHKHMUMHREQEW-TXQXMKJCSA-N |
| XLogP | 5.43 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|