C24H30N2O4 — CID 124939373
2-(1,3-benzodioxol-5-yloxy)-1-[(1R,2R,9R,10S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]ethanone (PubChem CID 124939373) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-1-[(1R,2R,9R,10S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-1-[(1R,2R,9R,10S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]ethanone |
|---|---|
| PubChem CID | 124939373 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-1-[(1R,2R,9R,10S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]ethanone |
| SMILES | O=C(COc1ccc2c(c1)OCO2)N1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@@H]34)[C@H]21 |
| InChI | InChI=1S/C24H30N2O4/c27-23(14-28-19-6-7-21-22(12-19)30-15-29-21)26-9-3-4-16-10-17-11-18(24(16)26)13-25-8-2-1-5-20(17)25/h6-7,10,12,17-18,20,24H,1-5,8-9,11,13-15H2/t17-,18+,20-,24-/m0/s1 |
| InChIKey | VBSIUGOTPKTTKF-KBVWPGPTSA-N |
| XLogP | 3.22 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|