C23H29ClN2O — CID 162914285
2-(4-chlorophenyl)-1-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)ethanone (PubChem CID 162914285) has the molecular formula C23H29ClN2O and a molecular weight of 384.95 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)ethanone |
|---|---|
| PubChem CID | 162914285 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CCCC2=CC3CC(CN4CCCCC34)C21 |
| InChI | InChI=1S/C23H29ClN2O/c24-20-8-6-16(7-9-20)12-22(27)26-11-3-4-17-13-18-14-19(23(17)26)15-25-10-2-1-5-21(18)25/h6-9,13,18-19,21,23H,1-5,10-12,14-15H2 |
| InChIKey | RZGJENDNOSHPQS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|