C26H33N3O — CID 154808856
1-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-(1-methylindol-3-yl)ethanone (PubChem CID 154808856) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-(1-methylindol-3-yl)ethanone.
| Compound Name | 1-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-(1-methylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 154808856 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-(1-methylindol-3-yl)ethanone |
| SMILES | Cn1cc(CC(=O)N2CCCC3=C[C@@H]4C[C@@H](CN5CCCCC45)C32)c2ccccc21 |
| InChI | InChI=1S/C26H33N3O/c1-27-16-20(22-8-2-3-10-24(22)27)15-25(30)29-12-6-7-18-13-19-14-21(26(18)29)17-28-11-5-4-9-23(19)28/h2-3,8,10,13,16,19,21,23,26H,4-7,9,11-12,14-15,17H2,1H3/t19-,21+,23?,26?/m1/s1 |
| InChIKey | CIXNLLJRNOWTJA-SHUCMAELSA-N |
| XLogP | 4.14 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|