C28H37N3O — CID 102564474
1-[(1S,9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-(1-propan-2-ylindol-3-yl)ethanone (PubChem CID 102564474) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is 1-[(1S,9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-(1-propan-2-ylindol-3-yl)ethanone.
| Compound Name | 1-[(1S,9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-(1-propan-2-ylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 102564474 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | 1-[(1S,9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-(1-propan-2-ylindol-3-yl)ethanone |
| SMILES | CC(C)n1cc(CC(=O)N2CCCC3=C[C@H]4C[C@@H](CN5CCCCC45)C32)c2ccccc21 |
| InChI | InChI=1S/C28H37N3O/c1-19(2)31-18-22(24-9-3-4-11-26(24)31)16-27(32)30-13-7-8-20-14-21-15-23(28(20)30)17-29-12-6-5-10-25(21)29/h3-4,9,11,14,18-19,21,23,25,28H,5-8,10,12-13,15-17H2,1-2H3/t21-,23-,25?,28?/m0/s1 |
| InChIKey | HRHOVZHGSNEKQV-LEKSUFQHSA-N |
| XLogP | 5.19 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|