C19H31N3O — CID 124903423
(1S,2R,9R,10R)-N-propan-2-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide (PubChem CID 124903423) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is (1S,2R,9R,10R)-N-propan-2-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide.
| Compound Name | (1S,2R,9R,10R)-N-propan-2-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide |
|---|---|
| PubChem CID | 124903423 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | (1S,2R,9R,10R)-N-propan-2-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide |
| SMILES | CC(C)NC(=O)N1CCCC2=C[C@H]3C[C@@H](CN4CCCC[C@H]34)[C@H]21 |
| InChI | InChI=1S/C19H31N3O/c1-13(2)20-19(23)22-9-5-6-14-10-15-11-16(18(14)22)12-21-8-4-3-7-17(15)21/h10,13,15-18H,3-9,11-12H2,1-2H3,(H,20,23)/t15-,16-,17+,18-/m0/s1 |
| InChIKey | ASOMGODJEYJOFE-FJIDUMEYSA-N |
| XLogP | 3.00 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|