C27H35N3O — CID 163059596
3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl-(1-propan-2-ylindol-6-yl)methanone (PubChem CID 163059596) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl-(1-propan-2-ylindol-6-yl)methanone.
| Compound Name | 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl-(1-propan-2-ylindol-6-yl)methanone |
|---|---|
| PubChem CID | 163059596 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl-(1-propan-2-ylindol-6-yl)methanone |
| SMILES | CC(C)n1ccc2ccc(C(=O)N3CCCC4=CC5CC(CN6CCCCC56)C43)cc21 |
| InChI | InChI=1S/C27H35N3O/c1-18(2)29-13-10-19-8-9-21(16-25(19)29)27(31)30-12-5-6-20-14-22-15-23(26(20)30)17-28-11-4-3-7-24(22)28/h8-10,13-14,16,18,22-24,26H,3-7,11-12,15,17H2,1-2H3 |
| InChIKey | IFQVDHKHKVDYQC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|