C21H25Cl2N3O — CID 171157041
[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-(2,6-dichloro-3-pyridinyl)methanone (PubChem CID 171157041) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is [(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-(2,6-dichloro-3-pyridinyl)methanone.
| Compound Name | [(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-(2,6-dichloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 171157041 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-(2,6-dichloro-3-pyridinyl)methanone |
| SMILES | O=C(c1ccc(Cl)nc1Cl)N1CCCC2=CC3CC(CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C21H25Cl2N3O/c22-18-7-6-16(20(23)24-18)21(27)26-9-3-4-13-10-14-11-15(19(13)26)12-25-8-2-1-5-17(14)25/h6-7,10,14-15,17,19H,1-5,8-9,11-12H2/t14?,15?,17-,19-/m1/s1 |
| InChIKey | JRJMZGVDWPHJIW-IUSFWMAGSA-N |
| XLogP | 4.42 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|