C36H48N4O2S — CID 118712530
[5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]thiophen-2-yl]-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methanone (PubChem CID 118712530) has the molecular formula C36H48N4O2S and a molecular weight of 600.87 g/mol. Its IUPAC name is [5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]thiophen-2-yl]-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methanone.
| Compound Name | [5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]thiophen-2-yl]-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methanone |
|---|---|
| PubChem CID | 118712530 |
| Molecular Formula | C36H48N4O2S |
| Molecular Weight | 600.87 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | [5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]thiophen-2-yl]-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methanone |
| SMILES | O=C(c1ccc(C(=O)N2CCCC3=C[C@H]4C[C@H](CN5CCCC[C@H]45)[C@@H]32)s1)N1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C36H48N4O2S/c41-35(39-15-5-7-23-17-25-19-27(33(23)39)21-37-13-3-1-9-29(25)37)31-11-12-32(43-31)36(42)40-16-6-8-24-18-26-20-28(34(24)40)22-38-14-4-2-10-30(26)38/h11-12,17-18,25-30,33-34H,1-10,13-16,19-22H2/t25-,26-,27+,28+,29+,30+,33+,34+/m0/s1 |
| InChIKey | OFGCDFSZKFIXGZ-JPCUOKRQSA-N |
| XLogP | 5.82 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.87 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|