C23H28N4O — CID 154808873
[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-(1H-indazol-3-yl)methanone (PubChem CID 154808873) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is [(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-(1H-indazol-3-yl)methanone.
| Compound Name | [(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 154808873 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CCCC2=C[C@@H]3C[C@@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C23H28N4O/c28-23(21-18-7-1-2-8-19(18)24-25-21)27-11-5-6-15-12-16-13-17(22(15)27)14-26-10-4-3-9-20(16)26/h1-2,7-8,12,16-17,20,22H,3-6,9-11,13-14H2,(H,24,25)/t16-,17+,20-,22-/m1/s1 |
| InChIKey | PMCDLQQXWDTKRI-IMLKGASGSA-N |
| XLogP | 3.60 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|