C24H28ClN3O — CID 154808899
(4-chloro-1H-indol-2-yl)-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methanone (PubChem CID 154808899) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is (4-chloro-1H-indol-2-yl)-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methanone.
| Compound Name | (4-chloro-1H-indol-2-yl)-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methanone |
|---|---|
| PubChem CID | 154808899 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (4-chloro-1H-indol-2-yl)-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methanone |
| SMILES | O=C(c1cc2c(Cl)cccc2[nH]1)N1CCCC2=C[C@@H]3C[C@@H](CN4CCCCC34)C21 |
| InChI | InChI=1S/C24H28ClN3O/c25-19-6-3-7-20-18(19)13-21(26-20)24(29)28-10-4-5-15-11-16-12-17(23(15)28)14-27-9-2-1-8-22(16)27/h3,6-7,11,13,16-17,22-23,26H,1-2,4-5,8-10,12,14H2/t16-,17+,22?,23?/m1/s1 |
| InChIKey | MUMOMJJBRFKSKD-FXAUUADQSA-N |
| XLogP | 4.86 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|