C25H27F2N3O2 — CID 171157271
3-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-6,8-difluoro-1H-quinolin-4-one (PubChem CID 171157271) has the molecular formula C25H27F2N3O2 and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-6,8-difluoro-1H-quinolin-4-one.
| Compound Name | 3-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-6,8-difluoro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 171157271 |
| Molecular Formula | C25H27F2N3O2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-6,8-difluoro-1H-quinolin-4-one |
| SMILES | O=C(c1c[nH]c2c(F)cc(F)cc2c1=O)N1CCCC2=CC3CC(CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C25H27F2N3O2/c26-17-10-18-22(20(27)11-17)28-12-19(24(18)31)25(32)30-7-3-4-14-8-15-9-16(23(14)30)13-29-6-2-1-5-21(15)29/h8,10-12,15-16,21,23H,1-7,9,13H2,(H,28,31)/t15?,16?,21-,23-/m1/s1 |
| InChIKey | FQYMRQHBDQFETD-OFFOUUCCSA-N |
| XLogP | 3.84 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|