C25H28FN3O2 — CID 124939093
3-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-6-fluoro-1H-quinolin-4-one (PubChem CID 124939093) has the molecular formula C25H28FN3O2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 3-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-6-fluoro-1H-quinolin-4-one.
| Compound Name | 3-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-6-fluoro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 124939093 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 3-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-6-fluoro-1H-quinolin-4-one |
| SMILES | O=C(c1c[nH]c2ccc(F)cc2c1=O)N1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C25H28FN3O2/c26-18-6-7-21-19(12-18)24(30)20(13-27-21)25(31)29-9-3-4-15-10-16-11-17(23(15)29)14-28-8-2-1-5-22(16)28/h6-7,10,12-13,16-17,22-23H,1-5,8-9,11,14H2,(H,27,30)/t16-,17+,22+,23+/m0/s1 |
| InChIKey | GGGUEYCQLIHTKW-MBKAAHDRSA-N |
| XLogP | 3.70 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|