C26H33N3O — CID 171152685
1-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-3-indol-1-ylpropan-1-one (PubChem CID 171152685) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-3-indol-1-ylpropan-1-one.
| Compound Name | 1-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-3-indol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 171152685 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-3-indol-1-ylpropan-1-one |
| SMILES | O=C(CCn1ccc2ccccc21)N1CCCC2=CC3CC(CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C26H33N3O/c30-25(11-15-27-14-10-19-6-1-2-8-23(19)27)29-13-5-7-20-16-21-17-22(26(20)29)18-28-12-4-3-9-24(21)28/h1-2,6,8,10,14,16,21-22,24,26H,3-5,7,9,11-13,15,17-18H2/t21?,22?,24-,26-/m1/s1 |
| InChIKey | FJWSWFYQJWQWGW-BZDYKRSESA-N |
| XLogP | 4.45 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|