C28H37N3O — CID 131665243
1-[(9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-4-(1-methylindol-3-yl)butan-1-one (PubChem CID 131665243) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is 1-[(9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-4-(1-methylindol-3-yl)butan-1-one.
| Compound Name | 1-[(9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-4-(1-methylindol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 131665243 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | 1-[(9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-4-(1-methylindol-3-yl)butan-1-one |
| SMILES | Cn1cc(CCCC(=O)N2CCCC3=C[C@H]4CC(CN5CCCCC45)C32)c2ccccc21 |
| InChI | InChI=1S/C28H37N3O/c1-29-18-21(24-10-2-3-12-26(24)29)8-6-13-27(32)31-15-7-9-20-16-22-17-23(28(20)31)19-30-14-5-4-11-25(22)30/h2-3,10,12,16,18,22-23,25,28H,4-9,11,13-15,17,19H2,1H3/t22-,23?,25?,28?/m0/s1 |
| InChIKey | BBBCUVRVWQGBDA-XGYQAPLBSA-N |
| XLogP | 4.92 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|