C26H32N4O2 — CID 146032434
2-[3-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-3-oxopropyl]-3H-quinazolin-4-one (PubChem CID 146032434) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-[3-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-3-oxopropyl]-3H-quinazolin-4-one.
| Compound Name | 2-[3-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-3-oxopropyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 146032434 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-[3-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-3-oxopropyl]-3H-quinazolin-4-one |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CCCC2=CC3CC(CN4CCCCC34)C21 |
| InChI | InChI=1S/C26H32N4O2/c31-24(11-10-23-27-21-8-2-1-7-20(21)26(32)28-23)30-13-5-6-17-14-18-15-19(25(17)30)16-29-12-4-3-9-22(18)29/h1-2,7-8,14,18-19,22,25H,3-6,9-13,15-16H2,(H,27,28,32) |
| InChIKey | BYQRZZAKUKCZOI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|