C27H34N4O3 — CID 125430742
(5S)-5-[3-[(1S,2R,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-3-oxopropyl]-3-phenylimidazolidine-2,4-dione (PubChem CID 125430742) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is (5S)-5-[3-[(1S,2R,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-3-oxopropyl]-3-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[3-[(1S,2R,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-3-oxopropyl]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 125430742 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (5S)-5-[3-[(1S,2R,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-3-oxopropyl]-3-phenylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@@H](CCC(=O)N2CCCC3=C[C@H]4C[C@@H](CN5CCCC[C@H]45)[C@H]32)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H34N4O3/c32-24(12-11-22-26(33)31(27(34)28-22)21-8-2-1-3-9-21)30-14-6-7-18-15-19-16-20(25(18)30)17-29-13-5-4-10-23(19)29/h1-3,8-9,15,19-20,22-23,25H,4-7,10-14,16-17H2,(H,28,34)/t19-,20-,22-,23+,25-/m0/s1 |
| InChIKey | YSMZWOLVKPNFJF-AUNLMLFCSA-N |
| XLogP | 3.31 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|