C27H34N4O4 — CID 135639766
5-[2-[(1R,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 135639766) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 5-[2-[(1R,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-[2-[(1R,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 135639766 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 5-[2-[(1R,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(N2C(=O)NC(CC(=O)N3CCCC4=C[C@@H]5C[C@H](CN6CCCCC56)C43)C2=O)cc1 |
| InChI | InChI=1S/C27H34N4O4/c1-35-21-9-7-20(8-10-21)31-26(33)22(28-27(31)34)15-24(32)30-12-4-5-17-13-18-14-19(25(17)30)16-29-11-3-2-6-23(18)29/h7-10,13,18-19,22-23,25H,2-6,11-12,14-16H2,1H3,(H,28,34)/t18-,19-,22?,23?,25?/m1/s1 |
| InChIKey | APDGGZSKDNZHTG-LOSCTUTRSA-N |
| XLogP | 2.93 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|