C28H36N4O4 — CID 171157879
(5S)-5-[2-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-2-oxoethyl]-3-[(2-methoxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 171157879) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is (5S)-5-[2-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-2-oxoethyl]-3-[(2-methoxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-2-oxoethyl]-3-[(2-methoxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 171157879 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (5S)-5-[2-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-2-oxoethyl]-3-[(2-methoxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccccc1CN1C(=O)N[C@@H](CC(=O)N2CCCC3=CC4CC(CN5CCCCC45)C32)C1=O |
| InChI | InChI=1S/C28H36N4O4/c1-36-24-10-3-2-7-19(24)17-32-27(34)22(29-28(32)35)15-25(33)31-12-6-8-18-13-20-14-21(26(18)31)16-30-11-5-4-9-23(20)30/h2-3,7,10,13,20-23,26H,4-6,8-9,11-12,14-17H2,1H3,(H,29,35)/t20?,21?,22-,23?,26?/m0/s1 |
| InChIKey | ZIEKDMFODVATIT-COGINZHSSA-N |
| XLogP | 2.93 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|