C27H33N3O2 — CID 171152679
2-(3-acetylindol-1-yl)-1-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]ethanone (PubChem CID 171152679) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-(3-acetylindol-1-yl)-1-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]ethanone.
| Compound Name | 2-(3-acetylindol-1-yl)-1-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]ethanone |
|---|---|
| PubChem CID | 171152679 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2-(3-acetylindol-1-yl)-1-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]ethanone |
| SMILES | CC(=O)c1cn(CC(=O)N2CCCC3=CC4CC(CN5CCCC[C@H]45)[C@@H]32)c2ccccc12 |
| InChI | InChI=1S/C27H33N3O2/c1-18(31)23-16-29(25-10-3-2-8-22(23)25)17-26(32)30-12-6-7-19-13-20-14-21(27(19)30)15-28-11-5-4-9-24(20)28/h2-3,8,10,13,16,20-21,24,27H,4-7,9,11-12,14-15,17H2,1H3/t20?,21?,24-,27-/m1/s1 |
| InChIKey | JPDWODBGKJNCFG-BXZFRKLZSA-N |
| XLogP | 4.27 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|