C27H35N3O2 — CID 110207022
[(1S,9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-[1-(2-methoxyethyl)indol-4-yl]methanone (PubChem CID 110207022) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is [(1S,9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-[1-(2-methoxyethyl)indol-4-yl]methanone.
| Compound Name | [(1S,9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-[1-(2-methoxyethyl)indol-4-yl]methanone |
|---|---|
| PubChem CID | 110207022 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | [(1S,9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-[1-(2-methoxyethyl)indol-4-yl]methanone |
| SMILES | COCCn1ccc2c(C(=O)N3CCCC4=C[C@H]5C[C@@H](CN6CCCCC56)C43)cccc21 |
| InChI | InChI=1S/C27H35N3O2/c1-32-15-14-28-13-10-22-23(7-4-9-25(22)28)27(31)30-12-5-6-19-16-20-17-21(26(19)30)18-29-11-3-2-8-24(20)29/h4,7,9-10,13,16,20-21,24,26H,2-3,5-6,8,11-12,14-15,17-18H2,1H3/t20-,21-,24?,26?/m0/s1 |
| InChIKey | WPYRGFYFQPALLS-AIOHXMOCSA-N |
| XLogP | 4.32 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|