C28H41N3O3 — CID 171364175
(1S)-N-[1-(3,4-dimethoxyphenyl)-2-methylpropyl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide (PubChem CID 171364175) has the molecular formula C28H41N3O3 and a molecular weight of 467.65 g/mol. Its IUPAC name is (1S)-N-[1-(3,4-dimethoxyphenyl)-2-methylpropyl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide.
| Compound Name | (1S)-N-[1-(3,4-dimethoxyphenyl)-2-methylpropyl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide |
|---|---|
| PubChem CID | 171364175 |
| Molecular Formula | C28H41N3O3 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | (1S)-N-[1-(3,4-dimethoxyphenyl)-2-methylpropyl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide |
| SMILES | COc1ccc(C(NC(=O)N2CCCC3=CC4C[C@@H](CN5CCCCC45)C32)C(C)C)cc1OC |
| InChI | InChI=1S/C28H41N3O3/c1-18(2)26(19-10-11-24(33-3)25(16-19)34-4)29-28(32)31-13-7-8-20-14-21-15-22(27(20)31)17-30-12-6-5-9-23(21)30/h10-11,14,16,18,21-23,26-27H,5-9,12-13,15,17H2,1-4H3,(H,29,32)/t21?,22-,23?,26?,27?/m0/s1 |
| InChIKey | VUKYGCWKRDSUIU-AANIIUONSA-N |
| XLogP | 5.01 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|