C24H33N3O2S — CID 5303159
(1R,2S,9S,10R)-N-(2,5-dimethoxyphenyl)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide (PubChem CID 5303159) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is (1R,2S,9S,10R)-N-(2,5-dimethoxyphenyl)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide.
| Compound Name | (1R,2S,9S,10R)-N-(2,5-dimethoxyphenyl)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide |
|---|---|
| PubChem CID | 5303159 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (1R,2S,9S,10R)-N-(2,5-dimethoxyphenyl)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide |
| SMILES | COc1ccc(OC)c(NC(=S)N2CCCC3=C[C@@H]4C[C@H](CN5CCCC[C@H]45)[C@@H]32)c1 |
| InChI | InChI=1S/C24H33N3O2S/c1-28-19-8-9-22(29-2)20(14-19)25-24(30)27-11-5-6-16-12-17-13-18(23(16)27)15-26-10-4-3-7-21(17)26/h8-9,12,14,17-18,21,23H,3-7,10-11,13,15H2,1-2H3,(H,25,30)/t17-,18-,21-,23-/m1/s1 |
| InChIKey | JILIKVVEDRWWEM-SVVKQXANSA-N |
| XLogP | 4.30 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|