C26H31N3S — CID 171153864
(2S,10R)-N-naphthalen-1-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide (PubChem CID 171153864) has the molecular formula C26H31N3S and a molecular weight of 417.62 g/mol. Its IUPAC name is (2S,10R)-N-naphthalen-1-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide.
| Compound Name | (2S,10R)-N-naphthalen-1-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide |
|---|---|
| PubChem CID | 171153864 |
| Molecular Formula | C26H31N3S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (2S,10R)-N-naphthalen-1-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide |
| SMILES | S=C(Nc1cccc2ccccc12)N1CCCC2=CC3CC(CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C26H31N3S/c30-26(27-23-11-5-8-18-7-1-2-10-22(18)23)29-14-6-9-19-15-20-16-21(25(19)29)17-28-13-4-3-12-24(20)28/h1-2,5,7-8,10-11,15,20-21,24-25H,3-4,6,9,12-14,16-17H2,(H,27,30)/t20?,21?,24-,25-/m1/s1 |
| InChIKey | JYFNVKBMCUQIFK-IVTPUCCMSA-N |
| XLogP | 5.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|