C19H29N3S — CID 99981159
(1R,2S,9R,10R)-N-cyclopropyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide (PubChem CID 99981159) has the molecular formula C19H29N3S and a molecular weight of 331.53 g/mol. Its IUPAC name is (1R,2S,9R,10R)-N-cyclopropyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide.
| Compound Name | (1R,2S,9R,10R)-N-cyclopropyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide |
|---|---|
| PubChem CID | 99981159 |
| Molecular Formula | C19H29N3S |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (1R,2S,9R,10R)-N-cyclopropyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide |
| SMILES | S=C(NC1CC1)N1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C19H29N3S/c23-19(20-16-6-7-16)22-9-3-4-13-10-14-11-15(18(13)22)12-21-8-2-1-5-17(14)21/h10,14-18H,1-9,11-12H2,(H,20,23)/t14-,15+,17+,18+/m0/s1 |
| InChIKey | PGSDIRMFGYBOJM-BURFUSLBSA-N |
| XLogP | 2.92 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|