C23H31N3S — CID 92980805
(1R,2S,9R,10R)-N-(2-methylphenyl)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide (PubChem CID 92980805) has the molecular formula C23H31N3S and a molecular weight of 381.59 g/mol. Its IUPAC name is (1R,2S,9R,10R)-N-(2-methylphenyl)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide.
| Compound Name | (1R,2S,9R,10R)-N-(2-methylphenyl)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide |
|---|---|
| PubChem CID | 92980805 |
| Molecular Formula | C23H31N3S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | (1R,2S,9R,10R)-N-(2-methylphenyl)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbothioamide |
| SMILES | Cc1ccccc1NC(=S)N1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C23H31N3S/c1-16-7-2-3-9-20(16)24-23(27)26-12-6-8-17-13-18-14-19(22(17)26)15-25-11-5-4-10-21(18)25/h2-3,7,9,13,18-19,21-22H,4-6,8,10-12,14-15H2,1H3,(H,24,27)/t18-,19+,21+,22+/m0/s1 |
| InChIKey | VRLCIZMQEFOIJA-YVNJGZBMSA-N |
| XLogP | 4.59 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|