C28H36N2O5 — CID 124939127
7-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethoxy]-5-hydroxy-2,2-dimethyl-3H-chromen-4-one (PubChem CID 124939127) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 7-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethoxy]-5-hydroxy-2,2-dimethyl-3H-chromen-4-one.
| Compound Name | 7-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethoxy]-5-hydroxy-2,2-dimethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 124939127 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 7-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethoxy]-5-hydroxy-2,2-dimethyl-3H-chromen-4-one |
| SMILES | CC1(C)CC(=O)c2c(O)cc(OCC(=O)N3CCCC4=C[C@H]5C[C@H](CN6CCCC[C@H]56)[C@@H]43)cc2O1 |
| InChI | InChI=1S/C28H36N2O5/c1-28(2)14-23(32)26-22(31)12-20(13-24(26)35-28)34-16-25(33)30-9-5-6-17-10-18-11-19(27(17)30)15-29-8-4-3-7-21(18)29/h10,12-13,18-19,21,27,31H,3-9,11,14-16H2,1-2H3/t18-,19+,21+,27+/m0/s1 |
| InChIKey | IBBOWHCQFLNGOV-CIVIXNTOSA-N |
| XLogP | 3.94 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|