C32H38N2O4 — CID 99885297
6-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-2,3,5,9-tetramethylfuro[3,2-g]chromen-7-one (PubChem CID 99885297) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is 6-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-2,3,5,9-tetramethylfuro[3,2-g]chromen-7-one.
| Compound Name | 6-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-2,3,5,9-tetramethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 99885297 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 6-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-2,3,5,9-tetramethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1oc2c(C)c3oc(=O)c(CC(=O)N4CCCC5=C[C@H]6C[C@H](CN7CCCC[C@H]67)[C@@H]54)c(C)c3cc2c1C |
| InChI | InChI=1S/C32H38N2O4/c1-17-20(4)37-30-19(3)31-25(14-24(17)30)18(2)26(32(36)38-31)15-28(35)34-11-7-8-21-12-22-13-23(29(21)34)16-33-10-6-5-9-27(22)33/h12,14,22-23,27,29H,5-11,13,15-16H2,1-4H3/t22-,23+,27+,29+/m0/s1 |
| InChIKey | PUKGBOVQWWGCRG-OTZAEGHNSA-N |
| XLogP | 5.74 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|