C27H34N2O3 — CID 122170032
8-[[(1S,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methyl]-7-hydroxy-3,4-dimethylchromen-2-one (PubChem CID 122170032) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 8-[[(1S,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methyl]-7-hydroxy-3,4-dimethylchromen-2-one.
| Compound Name | 8-[[(1S,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methyl]-7-hydroxy-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 122170032 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 8-[[(1S,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methyl]-7-hydroxy-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(O)c(CN3CCCC4=C[C@H]5C[C@@H](CN6CCCC[C@H]56)[C@@H]43)c2oc1=O |
| InChI | InChI=1S/C27H34N2O3/c1-16-17(2)27(31)32-26-21(16)8-9-24(30)22(26)15-29-11-5-6-18-12-19-13-20(25(18)29)14-28-10-4-3-7-23(19)28/h8-9,12,19-20,23,25,30H,3-7,10-11,13-15H2,1-2H3/t19-,20-,23+,25+/m0/s1 |
| InChIKey | BLPXUQYFGJKFFY-VRKOAZSQSA-N |
| XLogP | 4.51 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|