C29H35ClN2O3 — CID 125434550
2-chloro-4-[[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methyl]-3-hydroxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 125434550) has the molecular formula C29H35ClN2O3 and a molecular weight of 495.06 g/mol. Its IUPAC name is 2-chloro-4-[[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methyl]-3-hydroxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 2-chloro-4-[[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methyl]-3-hydroxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 125434550 |
| Molecular Formula | C29H35ClN2O3 |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-chloro-4-[[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]methyl]-3-hydroxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | O=c1oc2c(CN3CCCC4=C[C@H]5C[C@H](CN6CCCC[C@H]56)[C@@H]43)c(O)c(Cl)cc2c2c1CCCC2 |
| InChI | InChI=1S/C29H35ClN2O3/c30-24-14-22-20-7-1-2-8-21(20)29(34)35-28(22)23(27(24)33)16-32-11-5-6-17-12-18-13-19(26(17)32)15-31-10-4-3-9-25(18)31/h12,14,18-19,25-26,33H,1-11,13,15-16H2/t18-,19+,25+,26+/m0/s1 |
| InChIKey | XZXGUROTISUQQY-PTODGXCASA-N |
| XLogP | 5.43 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|