C28H36N2O3 — CID 135637995
8-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-ylmethyl)-7-hydroxy-4-propylchromen-2-one (PubChem CID 135637995) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 8-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-ylmethyl)-7-hydroxy-4-propylchromen-2-one.
| Compound Name | 8-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-ylmethyl)-7-hydroxy-4-propylchromen-2-one |
|---|---|
| PubChem CID | 135637995 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 8-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-ylmethyl)-7-hydroxy-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2c(CN3CCCC4=CC5CC(CN6CCCCC56)C43)c(O)ccc12 |
| InChI | InChI=1S/C28H36N2O3/c1-2-6-18-15-26(32)33-28-22(18)9-10-25(31)23(28)17-30-12-5-7-19-13-20-14-21(27(19)30)16-29-11-4-3-8-24(20)29/h9-10,13,15,20-21,24,27,31H,2-8,11-12,14,16-17H2,1H3 |
| InChIKey | GDYIMGGOVRPYTG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|