C21H33N3O3S — CID 138987244
2-[(1S,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 138987244) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is 2-[(1S,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[(1S,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 138987244 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[(1S,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CN1CCCC2=C[C@H]3C[C@@H](CN4CCCC[C@H]34)[C@@H]21)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H33N3O3S/c25-20(22-18-6-9-28(26,27)14-18)13-24-8-3-4-15-10-16-11-17(21(15)24)12-23-7-2-1-5-19(16)23/h10,16-19,21H,1-9,11-14H2,(H,22,25)/t16-,17-,18?,19+,21+/m0/s1 |
| InChIKey | TVMUGKQFAKHSJQ-UGRSUEEJSA-N |
| XLogP | 1.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|