C23H31N3O3S — CID 98218810
N-[4-[[(1R,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]sulfonyl]phenyl]acetamide (PubChem CID 98218810) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is N-[4-[[(1R,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[[(1R,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 98218810 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[4-[[(1R,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCCC3=C[C@@H]4C[C@H](CN5CCCC[C@H]45)[C@@H]32)cc1 |
| InChI | InChI=1S/C23H31N3O3S/c1-16(27)24-20-7-9-21(10-8-20)30(28,29)26-12-4-5-17-13-18-14-19(23(17)26)15-25-11-3-2-6-22(18)25/h7-10,13,18-19,22-23H,2-6,11-12,14-15H2,1H3,(H,24,27)/t18-,19-,22-,23-/m1/s1 |
| InChIKey | FXWWUJWKYUULRA-DAVBRLECSA-N |
| XLogP | 3.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|