C29H37ClN2O3 — CID 135637999
4-butyl-6-chloro-8-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-ylmethyl)-7-hydroxychromen-2-one (PubChem CID 135637999) has the molecular formula C29H37ClN2O3 and a molecular weight of 497.08 g/mol. Its IUPAC name is 4-butyl-6-chloro-8-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-ylmethyl)-7-hydroxychromen-2-one.
| Compound Name | 4-butyl-6-chloro-8-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-ylmethyl)-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 135637999 |
| Molecular Formula | C29H37ClN2O3 |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 4-butyl-6-chloro-8-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-ylmethyl)-7-hydroxychromen-2-one |
| SMILES | CCCCc1cc(=O)oc2c(CN3CCCC4=CC5CC(CN6CCCCC56)C43)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C29H37ClN2O3/c1-2-3-7-18-14-26(33)35-29-22(18)15-24(30)28(34)23(29)17-32-11-6-8-19-12-20-13-21(27(19)32)16-31-10-5-4-9-25(20)31/h12,14-15,20-21,25,27,34H,2-11,13,16-17H2,1H3 |
| InChIKey | GCTLTJXIRFPHAV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|