C28H33ClN2O4 — CID 99885352
6-chloro-3-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-7-methoxy-4-methylchromen-2-one (PubChem CID 99885352) has the molecular formula C28H33ClN2O4 and a molecular weight of 497.04 g/mol. Its IUPAC name is 6-chloro-3-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-7-methoxy-4-methylchromen-2-one.
| Compound Name | 6-chloro-3-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-7-methoxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 99885352 |
| Molecular Formula | C28H33ClN2O4 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 6-chloro-3-[2-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-7-methoxy-4-methylchromen-2-one |
| SMILES | COc1cc2oc(=O)c(CC(=O)N3CCCC4=C[C@H]5C[C@H](CN6CCCC[C@H]56)[C@@H]43)c(C)c2cc1Cl |
| InChI | InChI=1S/C28H33ClN2O4/c1-16-20-12-22(29)25(34-2)14-24(20)35-28(33)21(16)13-26(32)31-9-5-6-17-10-18-11-19(27(17)31)15-30-8-4-3-7-23(18)30/h10,12,14,18-19,23,27H,3-9,11,13,15H2,1-2H3/t18-,19+,23+,27+/m0/s1 |
| InChIKey | DCAAXUCSLBNEQL-PQWVSTDZSA-N |
| XLogP | 4.73 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|