C27H34N4O4 — CID 154808869
2-[2-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-7,8-dimethoxyphthalazin-1-one (PubChem CID 154808869) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[2-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-7,8-dimethoxyphthalazin-1-one.
| Compound Name | 2-[2-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-7,8-dimethoxyphthalazin-1-one |
|---|---|
| PubChem CID | 154808869 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-[2-[(1S,9S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-7,8-dimethoxyphthalazin-1-one |
| SMILES | COc1ccc2cnn(CC(=O)N3CCCC4=C[C@@H]5C[C@@H](CN6CCCCC56)C43)c(=O)c2c1OC |
| InChI | InChI=1S/C27H34N4O4/c1-34-22-9-8-18-14-28-31(27(33)24(18)26(22)35-2)16-23(32)30-11-5-6-17-12-19-13-20(25(17)30)15-29-10-4-3-7-21(19)29/h8-9,12,14,19-21,25H,3-7,10-11,13,15-16H2,1-2H3/t19-,20+,21?,25?/m1/s1 |
| InChIKey | WXVGQKSLOIXHMC-NNCHSUKDSA-N |
| XLogP | 2.84 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|