C22H25NO6S — CID 73256698
4-methylsulfanyl-2-[[2-(2,3,4,9-tetramethyl-7-oxofuro[2,3-f]chromen-8-yl)acetyl]amino]butanoic acid (PubChem CID 73256698) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[[2-(2,3,4,9-tetramethyl-7-oxofuro[2,3-f]chromen-8-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[[2-(2,3,4,9-tetramethyl-7-oxofuro[2,3-f]chromen-8-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 73256698 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-methylsulfanyl-2-[[2-(2,3,4,9-tetramethyl-7-oxofuro[2,3-f]chromen-8-yl)acetyl]amino]butanoic acid |
| SMILES | CSCCC(NC(=O)Cc1c(C)c2c(cc(C)c3c(C)c(C)oc32)oc1=O)C(=O)O |
| InChI | InChI=1S/C22H25NO6S/c1-10-8-16-19(20-18(10)11(2)13(4)28-20)12(3)14(22(27)29-16)9-17(24)23-15(21(25)26)6-7-30-5/h8,15H,6-7,9H2,1-5H3,(H,23,24)(H,25,26) |
| InChIKey | BNKMGIZLFZJVGR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|