C26H27FN2O5 — CID 46461280
3-[3-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one (PubChem CID 46461280) has the molecular formula C26H27FN2O5 and a molecular weight of 466.51 g/mol. Its IUPAC name is 3-[3-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one.
| Compound Name | 3-[3-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 46461280 |
| Molecular Formula | C26H27FN2O5 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 3-[3-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one |
| SMILES | COc1ccc2c(C)c(CCC(=O)N3CCN(C(=O)Cc4ccc(F)cc4)CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C26H27FN2O5/c1-17-21-8-7-20(33-2)16-23(21)34-26(32)22(17)9-10-24(30)28-11-13-29(14-12-28)25(31)15-18-3-5-19(27)6-4-18/h3-8,16H,9-15H2,1-2H3 |
| InChIKey | WJZXTXVUMRITPE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|