C18H21NO7S — CID 40816138
N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide (PubChem CID 40816138) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 40816138 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)N[C@@H]3CS(=O)(=O)C[C@H]3O)c(=O)oc2c1 |
| InChI | InChI=1S/C18H21NO7S/c1-10-12-4-3-11(25-2)7-16(12)26-18(22)13(10)5-6-17(21)19-14-8-27(23,24)9-15(14)20/h3-4,7,14-15,20H,5-6,8-9H2,1-2H3,(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | OCDADJYOELRIFF-HUUCEWRRSA-N |
| XLogP | 0.32 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|