C25H28N2O5 — CID 55708300
N-[3-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-4-methylphenyl]-2-methylpropanamide (PubChem CID 55708300) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[3-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-4-methylphenyl]-2-methylpropanamide.
| Compound Name | N-[3-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-4-methylphenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55708300 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[3-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-4-methylphenyl]-2-methylpropanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)Nc3cc(NC(=O)C(C)C)ccc3C)c(=O)oc2c1 |
| InChI | InChI=1S/C25H28N2O5/c1-14(2)24(29)26-17-7-6-15(3)21(12-17)27-23(28)11-10-20-16(4)19-9-8-18(31-5)13-22(19)32-25(20)30/h6-9,12-14H,10-11H2,1-5H3,(H,26,29)(H,27,28) |
| InChIKey | WKYZSINHQCLIFR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|