C24H23NO8 — CID 55459776
[1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate (PubChem CID 55459776) has the molecular formula C24H23NO8 and a molecular weight of 453.45 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate.
| Compound Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate |
|---|---|
| PubChem CID | 55459776 |
| Molecular Formula | C24H23NO8 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate |
| SMILES | COc1ccc2c(C)c(CCC(=O)OC(C)C(=O)Nc3ccc4c(c3)OCO4)c(=O)oc2c1 |
| InChI | InChI=1S/C24H23NO8/c1-13-17-6-5-16(29-3)11-20(17)33-24(28)18(13)7-9-22(26)32-14(2)23(27)25-15-4-8-19-21(10-15)31-12-30-19/h4-6,8,10-11,14H,7,9,12H2,1-3H3,(H,25,27) |
| InChIKey | XXOVWDJFQIPUFS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|