C26H29N3O5 — CID 55528687
3-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide (PubChem CID 55528687) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 3-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55528687 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 3-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)Nc3cc(C(N)=O)ccc3N3CCCCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C26H29N3O5/c1-16-19-8-7-18(33-2)15-23(19)34-26(32)20(16)9-11-24(30)28-21-14-17(25(27)31)6-10-22(21)29-12-4-3-5-13-29/h6-8,10,14-15H,3-5,9,11-13H2,1-2H3,(H2,27,31)(H,28,30) |
| InChIKey | XTDLFTSOMMLTGZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|