C25H28ClN3O4 — CID 35356789
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide (PubChem CID 35356789) has the molecular formula C25H28ClN3O4 and a molecular weight of 469.97 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 35356789 |
| Molecular Formula | C25H28ClN3O4 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)Nc3cc(Cl)ccc3N3CCN(C)CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H28ClN3O4/c1-16-19-6-5-18(32-3)15-23(19)33-25(31)20(16)7-9-24(30)27-21-14-17(26)4-8-22(21)29-12-10-28(2)11-13-29/h4-6,8,14-15H,7,9-13H2,1-3H3,(H,27,30) |
| InChIKey | ZNECFQVJTHOESR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|