C24H28N6O2S2 — CID 118554955
N-(1H-benzimidazol-2-ylmethyl)-4-[[4-(1H-benzimidazol-2-ylmethylamino)-4-oxobutyl]disulfanyl]butanamide (PubChem CID 118554955) has the molecular formula C24H28N6O2S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-4-[[4-(1H-benzimidazol-2-ylmethylamino)-4-oxobutyl]disulfanyl]butanamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-4-[[4-(1H-benzimidazol-2-ylmethylamino)-4-oxobutyl]disulfanyl]butanamide |
|---|---|
| PubChem CID | 118554955 |
| Molecular Formula | C24H28N6O2S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-4-[[4-(1H-benzimidazol-2-ylmethylamino)-4-oxobutyl]disulfanyl]butanamide |
| SMILES | O=C(CCCSSCCCC(=O)NCc1nc2ccccc2[nH]1)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H28N6O2S2/c31-23(25-15-21-27-17-7-1-2-8-18(17)28-21)11-5-13-33-34-14-6-12-24(32)26-16-22-29-19-9-3-4-10-20(19)30-22/h1-4,7-10H,5-6,11-16H2,(H,25,31)(H,26,32)(H,27,28)(H,29,30) |
| InChIKey | CKQNNYSVJDBHMW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|